About tert-butyl N-[(2R,3S)-2-methyl-4-oxooxetan-3-yl]carbamate
tert-butyl N-[(2R,3S)-2-methyl-4-oxooxetan-3-yl]carbamate (PubChem CID 24849149) has the molecular formula C9H15NO4
and a molecular weight of 201.22 g/mol. Its IUPAC name is tert-butyl N-[(2R,3S)-2-methyl-4-oxooxetan-3-yl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(2R,3S)-2-methyl-4-oxooxetan-3-yl]carbamate |
| PubChem CID | 24849149 |
| Molecular Formula | C9H15NO4 |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | tert-butyl N-[(2R,3S)-2-methyl-4-oxooxetan-3-yl]carbamate |
| SMILES | C[C@H]1OC(=O)[C@H]1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C9H15NO4/c1-5-6(7(11)13-5)10-8(12)14-9(2,3)4/h5-6H,1-4H3,(H,10,12)/t5-,6+/m1/s1 |
| InChIKey | ZITVZMOAHYMMJY-RITPCOANSA-N |
| XLogP | 0.82 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[(2R,3S)-2-methyl-4-oxooxetan-3-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(2R,3S)-2-methyl-4-oxooxetan-3-yl]carbamate?
The IUPAC name of tert-butyl N-[(2R,3S)-2-methyl-4-oxooxetan-3-yl]carbamate (CID 24849149) is tert-butyl N-[(2R,3S)-2-methyl-4-oxooxetan-3-yl]carbamate.
What is the SMILES notation for tert-butyl N-[(2R,3S)-2-methyl-4-oxooxetan-3-yl]carbamate?
The canonical SMILES for tert-butyl N-[(2R,3S)-2-methyl-4-oxooxetan-3-yl]carbamate is C[C@H]1OC(=O)[C@H]1NC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl N-[(2R,3S)-2-methyl-4-oxooxetan-3-yl]carbamate?
The InChIKey is ZITVZMOAHYMMJY-RITPCOANSA-N. The full InChI is InChI=1S/C9H15NO4/c1-5-6(7(11)13-5)10-8(12)14-9(2,3)4/h5-6H,1-4H3,(H,10,12)/t5-,6+/m1/s1.
What are the key properties of tert-butyl N-[(2R,3S)-2-methyl-4-oxooxetan-3-yl]carbamate?
tert-butyl N-[(2R,3S)-2-methyl-4-oxooxetan-3-yl]carbamate has a molecular weight of 201.22 g/mol, XLogP of 0.82, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(2R,3S)-2-methyl-4-oxooxetan-3-yl]carbamate is sourced from PubChem (CID 24849149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).