About 4-[2-(2,4-dihydroxyphenyl)ethyl]benzene-1,3-diol
4-[2-(2,4-dihydroxyphenyl)ethyl]benzene-1,3-diol (PubChem CID 24849532) has the molecular formula C14H14O4
and a molecular weight of 246.26 g/mol. Its IUPAC name is 4-[2-(2,4-dihydroxyphenyl)ethyl]benzene-1,3-diol.
Molecular Properties
| Compound Name | 4-[2-(2,4-dihydroxyphenyl)ethyl]benzene-1,3-diol |
| PubChem CID | 24849532 |
| Molecular Formula | C14H14O4 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 4-[2-(2,4-dihydroxyphenyl)ethyl]benzene-1,3-diol |
| SMILES | Oc1ccc(CCc2ccc(O)cc2O)c(O)c1 |
| InChI | InChI=1S/C14H14O4/c15-11-5-3-9(13(17)7-11)1-2-10-4-6-12(16)8-14(10)18/h3-8,15-18H,1-2H2 |
| InChIKey | WKIFTWPZTZUMRN-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[2-(2,4-dihydroxyphenyl)ethyl]benzene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(2,4-dihydroxyphenyl)ethyl]benzene-1,3-diol?
The IUPAC name of 4-[2-(2,4-dihydroxyphenyl)ethyl]benzene-1,3-diol (CID 24849532) is 4-[2-(2,4-dihydroxyphenyl)ethyl]benzene-1,3-diol.
What is the SMILES notation for 4-[2-(2,4-dihydroxyphenyl)ethyl]benzene-1,3-diol?
The canonical SMILES for 4-[2-(2,4-dihydroxyphenyl)ethyl]benzene-1,3-diol is Oc1ccc(CCc2ccc(O)cc2O)c(O)c1.
What is the InChIKey of 4-[2-(2,4-dihydroxyphenyl)ethyl]benzene-1,3-diol?
The InChIKey is WKIFTWPZTZUMRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O4/c15-11-5-3-9(13(17)7-11)1-2-10-4-6-12(16)8-14(10)18/h3-8,15-18H,1-2H2.
What are the key properties of 4-[2-(2,4-dihydroxyphenyl)ethyl]benzene-1,3-diol?
4-[2-(2,4-dihydroxyphenyl)ethyl]benzene-1,3-diol has a molecular weight of 246.26 g/mol, XLogP of 2.29, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(2,4-dihydroxyphenyl)ethyl]benzene-1,3-diol is sourced from PubChem (CID 24849532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).