C28H34ClN5O7S2 — CID 24850038
S-[[4-[(5-chlorothiophene-2-carbonyl)-[[(5S)-2-oxo-3-[4-(3-oxomorpholin-4-yl)phenyl]-1,3-oxazolidin-5-yl]methyl]amino]-4-oxobutyl]amino] (2R)-2-amino-3-methylbutanethioate (PubChem CID 24850038) has the molecular formula C28H34ClN5O7S2 and a molecular weight of 652.20 g/mol. Its IUPAC name is S-[[4-[(5-chlorothiophene-2-carbonyl)-[[(5S)-2-oxo-3-[4-(3-oxomorpholin-4-yl)phenyl]-1,3-oxazolidin-5-yl]methyl]amino]-4-oxobutyl]amino] (2R)-2-amino-3-methylbutanethioate.
| Compound Name | S-[[4-[(5-chlorothiophene-2-carbonyl)-[[(5S)-2-oxo-3-[4-(3-oxomorpholin-4-yl)phenyl]-1,3-oxazolidin-5-yl]methyl]amino]-4-oxobutyl]amino] (2R)-2-amino-3-methylbutanethioate |
|---|---|
| PubChem CID | 24850038 |
| Molecular Formula | C28H34ClN5O7S2 |
| Molecular Weight | 652.20 g/mol |
| Exact Mass | 651.16 |
| IUPAC Name | S-[[4-[(5-chlorothiophene-2-carbonyl)-[[(5S)-2-oxo-3-[4-(3-oxomorpholin-4-yl)phenyl]-1,3-oxazolidin-5-yl]methyl]amino]-4-oxobutyl]amino] (2R)-2-amino-3-methylbutanethioate |
| SMILES | CC(C)[C@@H](N)C(=O)SNCCCC(=O)N(C[C@H]1CN(c2ccc(N3CCOCC3=O)cc2)C(=O)O1)C(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C28H34ClN5O7S2/c1-17(2)25(30)27(38)43-31-11-3-4-23(35)34(26(37)21-9-10-22(29)42-21)15-20-14-33(28(39)41-20)19-7-5-18(6-8-19)32-12-13-40-16-24(32)36/h5-10,17,20,25,31H,3-4,11-16,30H2,1-2H3/t20-,25-/m1/s1 |
| InChIKey | KRMQCSYWRWOIFF-CJFMBICVSA-N |
| XLogP | 3.29 |
| TPSA | 151.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.20 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|