C18H24O5 — CID 24850096
(5R)-5-[4-[(1S,5R)-1-hydroxy-4-oxo-5-[(E)-2-oxopent-3-enyl]cyclopent-2-en-1-yl]butyl]oxolan-2-one (PubChem CID 24850096) has the molecular formula C18H24O5 and a molecular weight of 320.38 g/mol. Its IUPAC name is (5R)-5-[4-[(1S,5R)-1-hydroxy-4-oxo-5-[(E)-2-oxopent-3-enyl]cyclopent-2-en-1-yl]butyl]oxolan-2-one.
| Compound Name | (5R)-5-[4-[(1S,5R)-1-hydroxy-4-oxo-5-[(E)-2-oxopent-3-enyl]cyclopent-2-en-1-yl]butyl]oxolan-2-one |
|---|---|
| PubChem CID | 24850096 |
| Molecular Formula | C18H24O5 |
| Molecular Weight | 320.38 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | (5R)-5-[4-[(1S,5R)-1-hydroxy-4-oxo-5-[(E)-2-oxopent-3-enyl]cyclopent-2-en-1-yl]butyl]oxolan-2-one |
| SMILES | C/C=C/C(=O)C[C@H]1C(=O)C=C[C@@]1(O)CCCC[C@@H]1CCC(=O)O1 |
| InChI | InChI=1S/C18H24O5/c1-2-5-13(19)12-15-16(20)9-11-18(15,22)10-4-3-6-14-7-8-17(21)23-14/h2,5,9,11,14-15,22H,3-4,6-8,10,12H2,1H3/b5-2+/t14-,15+,18+/m1/s1 |
| InChIKey | OKGIACCGHKKYEE-UFJAJOHRSA-N |
| XLogP | 2.27 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.38 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|