C20H24FNO3S — CID 24850421
N-[[6-(3-fluorophenyl)sulfonyl-1,2,3,4-tetrahydronaphthalen-1-yl]methyl]-2-methoxyethanamine (PubChem CID 24850421) has the molecular formula C20H24FNO3S and a molecular weight of 377.48 g/mol. Its IUPAC name is N-[[6-(3-fluorophenyl)sulfonyl-1,2,3,4-tetrahydronaphthalen-1-yl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[6-(3-fluorophenyl)sulfonyl-1,2,3,4-tetrahydronaphthalen-1-yl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 24850421 |
| Molecular Formula | C20H24FNO3S |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | N-[[6-(3-fluorophenyl)sulfonyl-1,2,3,4-tetrahydronaphthalen-1-yl]methyl]-2-methoxyethanamine |
| SMILES | COCCNCC1CCCc2cc(S(=O)(=O)c3cccc(F)c3)ccc21 |
| InChI | InChI=1S/C20H24FNO3S/c1-25-11-10-22-14-16-5-2-4-15-12-19(8-9-20(15)16)26(23,24)18-7-3-6-17(21)13-18/h3,6-9,12-13,16,22H,2,4-5,10-11,14H2,1H3 |
| InChIKey | LOAFZNVXNLHXAK-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|