C19H21F2NO3S — CID 24850426
2-[[5-fluoro-6-(3-fluorophenyl)sulfonyl-1,2,3,4-tetrahydronaphthalen-1-yl]methylamino]ethanol (PubChem CID 24850426) has the molecular formula C19H21F2NO3S and a molecular weight of 381.44 g/mol. Its IUPAC name is 2-[[5-fluoro-6-(3-fluorophenyl)sulfonyl-1,2,3,4-tetrahydronaphthalen-1-yl]methylamino]ethanol.
| Compound Name | 2-[[5-fluoro-6-(3-fluorophenyl)sulfonyl-1,2,3,4-tetrahydronaphthalen-1-yl]methylamino]ethanol |
|---|---|
| PubChem CID | 24850426 |
| Molecular Formula | C19H21F2NO3S |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | 2-[[5-fluoro-6-(3-fluorophenyl)sulfonyl-1,2,3,4-tetrahydronaphthalen-1-yl]methylamino]ethanol |
| SMILES | O=S(=O)(c1cccc(F)c1)c1ccc2c(c1F)CCCC2CNCCO |
| InChI | InChI=1S/C19H21F2NO3S/c20-14-4-2-5-15(11-14)26(24,25)18-8-7-16-13(12-22-9-10-23)3-1-6-17(16)19(18)21/h2,4-5,7-8,11,13,22-23H,1,3,6,9-10,12H2 |
| InChIKey | JSYDDERRIRUBJB-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|