C29H50N4O4 — CID 24850437
N-[3-amino-5-[[1-(3-ethoxypropyl)indazol-6-yl]-hydroxymethyl]-2-hydroxy-6-methylheptyl]-2,2-dimethylhexanamide (PubChem CID 24850437) has the molecular formula C29H50N4O4 and a molecular weight of 518.74 g/mol. Its IUPAC name is N-[3-amino-5-[[1-(3-ethoxypropyl)indazol-6-yl]-hydroxymethyl]-2-hydroxy-6-methylheptyl]-2,2-dimethylhexanamide.
| Compound Name | N-[3-amino-5-[[1-(3-ethoxypropyl)indazol-6-yl]-hydroxymethyl]-2-hydroxy-6-methylheptyl]-2,2-dimethylhexanamide |
|---|---|
| PubChem CID | 24850437 |
| Molecular Formula | C29H50N4O4 |
| Molecular Weight | 518.74 g/mol |
| Exact Mass | 518.38 |
| IUPAC Name | N-[3-amino-5-[[1-(3-ethoxypropyl)indazol-6-yl]-hydroxymethyl]-2-hydroxy-6-methylheptyl]-2,2-dimethylhexanamide |
| SMILES | CCCCC(C)(C)C(=O)NCC(O)C(N)CC(C(C)C)C(O)c1ccc2cnn(CCCOCC)c2c1 |
| InChI | InChI=1S/C29H50N4O4/c1-7-9-13-29(5,6)28(36)31-19-26(34)24(30)17-23(20(3)4)27(35)21-11-12-22-18-32-33(25(22)16-21)14-10-15-37-8-2/h11-12,16,18,20,23-24,26-27,34-35H,7-10,13-15,17,19,30H2,1-6H3,(H,31,36) |
| InChIKey | FXFJXVVAYUUOHM-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 122.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.74 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|