C28H48N4O4 — CID 24850438
N-[3-amino-2-hydroxy-5-[hydroxy-[1-(3-methoxypropyl)indazol-6-yl]methyl]-6-methylheptyl]-2,2-dimethylhexanamide (PubChem CID 24850438) has the molecular formula C28H48N4O4 and a molecular weight of 504.72 g/mol. Its IUPAC name is N-[3-amino-2-hydroxy-5-[hydroxy-[1-(3-methoxypropyl)indazol-6-yl]methyl]-6-methylheptyl]-2,2-dimethylhexanamide.
| Compound Name | N-[3-amino-2-hydroxy-5-[hydroxy-[1-(3-methoxypropyl)indazol-6-yl]methyl]-6-methylheptyl]-2,2-dimethylhexanamide |
|---|---|
| PubChem CID | 24850438 |
| Molecular Formula | C28H48N4O4 |
| Molecular Weight | 504.72 g/mol |
| Exact Mass | 504.37 |
| IUPAC Name | N-[3-amino-2-hydroxy-5-[hydroxy-[1-(3-methoxypropyl)indazol-6-yl]methyl]-6-methylheptyl]-2,2-dimethylhexanamide |
| SMILES | CCCCC(C)(C)C(=O)NCC(O)C(N)CC(C(C)C)C(O)c1ccc2cnn(CCCOC)c2c1 |
| InChI | InChI=1S/C28H48N4O4/c1-7-8-12-28(4,5)27(35)30-18-25(33)23(29)16-22(19(2)3)26(34)20-10-11-21-17-31-32(24(21)15-20)13-9-14-36-6/h10-11,15,17,19,22-23,25-26,33-34H,7-9,12-14,16,18,29H2,1-6H3,(H,30,35) |
| InChIKey | DLNGKEXENIYFGE-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 122.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.72 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|