C28H48N4O3 — CID 24850478
N-[(2S,3S,5S)-3-amino-2-hydroxy-5-[[1-(3-methoxypropyl)indazol-6-yl]methyl]-6-methylheptyl]-2,2-dimethylhexanamide (PubChem CID 24850478) has the molecular formula C28H48N4O3 and a molecular weight of 488.72 g/mol. Its IUPAC name is N-[(2S,3S,5S)-3-amino-2-hydroxy-5-[[1-(3-methoxypropyl)indazol-6-yl]methyl]-6-methylheptyl]-2,2-dimethylhexanamide.
| Compound Name | N-[(2S,3S,5S)-3-amino-2-hydroxy-5-[[1-(3-methoxypropyl)indazol-6-yl]methyl]-6-methylheptyl]-2,2-dimethylhexanamide |
|---|---|
| PubChem CID | 24850478 |
| Molecular Formula | C28H48N4O3 |
| Molecular Weight | 488.72 g/mol |
| Exact Mass | 488.37 |
| IUPAC Name | N-[(2S,3S,5S)-3-amino-2-hydroxy-5-[[1-(3-methoxypropyl)indazol-6-yl]methyl]-6-methylheptyl]-2,2-dimethylhexanamide |
| SMILES | CCCCC(C)(C)C(=O)NC[C@H](O)[C@@H](N)C[C@H](Cc1ccc2cnn(CCCOC)c2c1)C(C)C |
| InChI | InChI=1S/C28H48N4O3/c1-7-8-12-28(4,5)27(34)30-19-26(33)24(29)17-23(20(2)3)15-21-10-11-22-18-31-32(25(22)16-21)13-9-14-35-6/h10-11,16,18,20,23-24,26,33H,7-9,12-15,17,19,29H2,1-6H3,(H,30,34)/t23-,24-,26-/m0/s1 |
| InChIKey | YPPXAXKGIGEGNM-GNKBHMEESA-N |
| XLogP | 4.30 |
| TPSA | 102.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.72 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|