C14H9F15N2S — CID 24850601
2-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl)-2-[3-(trifluoromethylsulfanyl)propyl]propanedinitrile (PubChem CID 24850601) has the molecular formula C14H9F15N2S and a molecular weight of 522.28 g/mol. Its IUPAC name is 2-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl)-2-[3-(trifluoromethylsulfanyl)propyl]propanedinitrile.
| Compound Name | 2-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl)-2-[3-(trifluoromethylsulfanyl)propyl]propanedinitrile |
|---|---|
| PubChem CID | 24850601 |
| Molecular Formula | C14H9F15N2S |
| Molecular Weight | 522.28 g/mol |
| Exact Mass | 522.02 |
| IUPAC Name | 2-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl)-2-[3-(trifluoromethylsulfanyl)propyl]propanedinitrile |
| SMILES | N#CC(C#N)(CCCSC(F)(F)F)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C14H9F15N2S/c15-7(16)10(19,20)12(23,24)13(25,26)11(21,22)9(17,18)4-8(5-30,6-31)2-1-3-32-14(27,28)29/h7H,1-4H2 |
| InChIKey | PVIKFKSTAALXNT-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.28 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|