C13H8F14N2S — CID 24850602
2-[3-(trifluoromethylsulfanyl)propyl]-2-(2,2,3,3,4,4,5,5,6,6,6-undecafluorohexyl)propanedinitrile (PubChem CID 24850602) has the molecular formula C13H8F14N2S and a molecular weight of 490.26 g/mol. Its IUPAC name is 2-[3-(trifluoromethylsulfanyl)propyl]-2-(2,2,3,3,4,4,5,5,6,6,6-undecafluorohexyl)propanedinitrile.
| Compound Name | 2-[3-(trifluoromethylsulfanyl)propyl]-2-(2,2,3,3,4,4,5,5,6,6,6-undecafluorohexyl)propanedinitrile |
|---|---|
| PubChem CID | 24850602 |
| Molecular Formula | C13H8F14N2S |
| Molecular Weight | 490.26 g/mol |
| Exact Mass | 490.02 |
| IUPAC Name | 2-[3-(trifluoromethylsulfanyl)propyl]-2-(2,2,3,3,4,4,5,5,6,6,6-undecafluorohexyl)propanedinitrile |
| SMILES | N#CC(C#N)(CCCSC(F)(F)F)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H8F14N2S/c14-8(15,9(16,17)10(18,19)11(20,21)12(22,23)24)4-7(5-28,6-29)2-1-3-30-13(25,26)27/h1-4H2 |
| InChIKey | BRDAMSYPXYIJDB-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.26 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|