C12H9F11N2S — CID 24850603
2-(2,2,3,3,4,4,5,5-octafluoropentyl)-2-[3-(trifluoromethylsulfanyl)propyl]propanedinitrile (PubChem CID 24850603) has the molecular formula C12H9F11N2S and a molecular weight of 422.26 g/mol. Its IUPAC name is 2-(2,2,3,3,4,4,5,5-octafluoropentyl)-2-[3-(trifluoromethylsulfanyl)propyl]propanedinitrile.
| Compound Name | 2-(2,2,3,3,4,4,5,5-octafluoropentyl)-2-[3-(trifluoromethylsulfanyl)propyl]propanedinitrile |
|---|---|
| PubChem CID | 24850603 |
| Molecular Formula | C12H9F11N2S |
| Molecular Weight | 422.26 g/mol |
| Exact Mass | 422.03 |
| IUPAC Name | 2-(2,2,3,3,4,4,5,5-octafluoropentyl)-2-[3-(trifluoromethylsulfanyl)propyl]propanedinitrile |
| SMILES | N#CC(C#N)(CCCSC(F)(F)F)CC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C12H9F11N2S/c13-7(14)10(17,18)11(19,20)9(15,16)4-8(5-24,6-25)2-1-3-26-12(21,22)23/h7H,1-4H2 |
| InChIKey | SKUOCRCCLROZNT-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.26 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|