C15H20N6OS2 — CID 24850900
2-butan-2-ylsulfanyl-5-[1-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]ethyl]-1,3,4-oxadiazole (PubChem CID 24850900) has the molecular formula C15H20N6OS2 and a molecular weight of 364.50 g/mol. Its IUPAC name is 2-butan-2-ylsulfanyl-5-[1-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]ethyl]-1,3,4-oxadiazole.
| Compound Name | 2-butan-2-ylsulfanyl-5-[1-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]ethyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 24850900 |
| Molecular Formula | C15H20N6OS2 |
| Molecular Weight | 364.50 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 2-butan-2-ylsulfanyl-5-[1-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]ethyl]-1,3,4-oxadiazole |
| SMILES | CCC(C)Sc1nnc(C(C)Sc2nc3nc(C)cc(C)n3n2)o1 |
| InChI | InChI=1S/C15H20N6OS2/c1-6-10(4)23-15-19-18-12(22-15)11(5)24-14-17-13-16-8(2)7-9(3)21(13)20-14/h7,10-11H,6H2,1-5H3 |
| InChIKey | SUPYXWBRLQZAPQ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 82.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.50 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |