About 3-(3-methylimidazol-3-ium-1-yl)propane-1,2-diol
3-(3-methylimidazol-3-ium-1-yl)propane-1,2-diol (PubChem CID 24851222) has the molecular formula C7H13N2O2+
and a molecular weight of 157.19 g/mol. Its IUPAC name is 3-(3-methylimidazol-3-ium-1-yl)propane-1,2-diol.
Molecular Properties
| Compound Name | 3-(3-methylimidazol-3-ium-1-yl)propane-1,2-diol |
| PubChem CID | 24851222 |
| Molecular Formula | C7H13N2O2+ |
| Molecular Weight | 157.19 g/mol |
| Exact Mass | 157.10 |
| IUPAC Name | 3-(3-methylimidazol-3-ium-1-yl)propane-1,2-diol |
| SMILES | C[n+]1ccn(CC(O)CO)c1 |
| InChI | InChI=1S/C7H13N2O2/c1-8-2-3-9(6-8)4-7(11)5-10/h2-3,6-7,10-11H,4-5H2,1H3/q+1 |
| InChIKey | LWGIQPNZYVSQQV-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 49.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.19 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-methylimidazol-3-ium-1-yl)propane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-methylimidazol-3-ium-1-yl)propane-1,2-diol?
The IUPAC name of 3-(3-methylimidazol-3-ium-1-yl)propane-1,2-diol (CID 24851222) is 3-(3-methylimidazol-3-ium-1-yl)propane-1,2-diol.
What is the SMILES notation for 3-(3-methylimidazol-3-ium-1-yl)propane-1,2-diol?
The canonical SMILES for 3-(3-methylimidazol-3-ium-1-yl)propane-1,2-diol is C[n+]1ccn(CC(O)CO)c1.
What is the InChIKey of 3-(3-methylimidazol-3-ium-1-yl)propane-1,2-diol?
The InChIKey is LWGIQPNZYVSQQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N2O2/c1-8-2-3-9(6-8)4-7(11)5-10/h2-3,6-7,10-11H,4-5H2,1H3/q+1.
What are the key properties of 3-(3-methylimidazol-3-ium-1-yl)propane-1,2-diol?
3-(3-methylimidazol-3-ium-1-yl)propane-1,2-diol has a molecular weight of 157.19 g/mol, XLogP of -1.33, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-methylimidazol-3-ium-1-yl)propane-1,2-diol is sourced from PubChem (CID 24851222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).