About 2-[[(E,7R)-1-iodotridec-5-en-7-yl]oxymethoxy]ethyl-trimethylsilane
2-[[(E,7R)-1-iodotridec-5-en-7-yl]oxymethoxy]ethyl-trimethylsilane (PubChem CID 24851247) has the molecular formula C19H39IO2Si
and a molecular weight of 454.51 g/mol. Its IUPAC name is 2-[[(E,7R)-1-iodotridec-5-en-7-yl]oxymethoxy]ethyl-trimethylsilane.
Molecular Properties
| Compound Name | 2-[[(E,7R)-1-iodotridec-5-en-7-yl]oxymethoxy]ethyl-trimethylsilane |
| PubChem CID | 24851247 |
| Molecular Formula | C19H39IO2Si |
| Molecular Weight | 454.51 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | 2-[[(E,7R)-1-iodotridec-5-en-7-yl]oxymethoxy]ethyl-trimethylsilane |
| SMILES | CCCCCC[C@H](/C=C/CCCCI)OCOCC[Si](C)(C)C |
| InChI | InChI=1S/C19H39IO2Si/c1-5-6-7-10-13-19(14-11-8-9-12-15-20)22-18-21-16-17-23(2,3)4/h11,14,19H,5-10,12-13,15-18H2,1-4H3/b14-11+/t19-/m1/s1 |
| InChIKey | AUODDDVXITYOLO-FIIODCPWSA-N |
| XLogP | 6.82 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 454.51 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-[[(E,7R)-1-iodotridec-5-en-7-yl]oxymethoxy]ethyl-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(E,7R)-1-iodotridec-5-en-7-yl]oxymethoxy]ethyl-trimethylsilane?
The IUPAC name of 2-[[(E,7R)-1-iodotridec-5-en-7-yl]oxymethoxy]ethyl-trimethylsilane (CID 24851247) is 2-[[(E,7R)-1-iodotridec-5-en-7-yl]oxymethoxy]ethyl-trimethylsilane.
What is the SMILES notation for 2-[[(E,7R)-1-iodotridec-5-en-7-yl]oxymethoxy]ethyl-trimethylsilane?
The canonical SMILES for 2-[[(E,7R)-1-iodotridec-5-en-7-yl]oxymethoxy]ethyl-trimethylsilane is CCCCCC[C@H](/C=C/CCCCI)OCOCC[Si](C)(C)C.
What is the InChIKey of 2-[[(E,7R)-1-iodotridec-5-en-7-yl]oxymethoxy]ethyl-trimethylsilane?
The InChIKey is AUODDDVXITYOLO-FIIODCPWSA-N. The full InChI is InChI=1S/C19H39IO2Si/c1-5-6-7-10-13-19(14-11-8-9-12-15-20)22-18-21-16-17-23(2,3)4/h11,14,19H,5-10,12-13,15-18H2,1-4H3/b14-11+/t19-/m1/s1.
What are the key properties of 2-[[(E,7R)-1-iodotridec-5-en-7-yl]oxymethoxy]ethyl-trimethylsilane?
2-[[(E,7R)-1-iodotridec-5-en-7-yl]oxymethoxy]ethyl-trimethylsilane has a molecular weight of 454.51 g/mol, XLogP of 6.82, 16 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(E,7R)-1-iodotridec-5-en-7-yl]oxymethoxy]ethyl-trimethylsilane is sourced from PubChem (CID 24851247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).