C8Cl2F8 — CID 24851311
1,4-bis[chloro(difluoro)methyl]-2,3,5,6-tetrafluorobenzene (PubChem CID 24851311) has the molecular formula C8Cl2F8 and a molecular weight of 318.98 g/mol. Its IUPAC name is 1,4-bis[chloro(difluoro)methyl]-2,3,5,6-tetrafluorobenzene.
| Compound Name | 1,4-bis[chloro(difluoro)methyl]-2,3,5,6-tetrafluorobenzene |
|---|---|
| PubChem CID | 24851311 |
| Molecular Formula | C8Cl2F8 |
| Molecular Weight | 318.98 g/mol |
| Exact Mass | 317.92 |
| IUPAC Name | 1,4-bis[chloro(difluoro)methyl]-2,3,5,6-tetrafluorobenzene |
| SMILES | Fc1c(F)c(C(F)(F)Cl)c(F)c(F)c1C(F)(F)Cl |
| InChI | InChI=1S/C8Cl2F8/c9-7(15,16)1-3(11)5(13)2(8(10,17)18)6(14)4(1)12 |
| InChIKey | DTVAMBZXZSKQGJ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.98 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|