C22H23Cl2N9O3 — CID 24851353
1-[2-[2-[(6-amino-5-nitro-2-pyridinyl)amino]ethylamino]-4-(2,4-dichlorophenyl)pyrimidin-5-yl]-4-methylpiperazin-2-one (PubChem CID 24851353) has the molecular formula C22H23Cl2N9O3 and a molecular weight of 532.39 g/mol. Its IUPAC name is 1-[2-[2-[(6-amino-5-nitro-2-pyridinyl)amino]ethylamino]-4-(2,4-dichlorophenyl)pyrimidin-5-yl]-4-methylpiperazin-2-one.
| Compound Name | 1-[2-[2-[(6-amino-5-nitro-2-pyridinyl)amino]ethylamino]-4-(2,4-dichlorophenyl)pyrimidin-5-yl]-4-methylpiperazin-2-one |
|---|---|
| PubChem CID | 24851353 |
| Molecular Formula | C22H23Cl2N9O3 |
| Molecular Weight | 532.39 g/mol |
| Exact Mass | 531.13 |
| IUPAC Name | 1-[2-[2-[(6-amino-5-nitro-2-pyridinyl)amino]ethylamino]-4-(2,4-dichlorophenyl)pyrimidin-5-yl]-4-methylpiperazin-2-one |
| SMILES | CN1CCN(c2cnc(NCCNc3ccc([N+](=O)[O-])c(N)n3)nc2-c2ccc(Cl)cc2Cl)C(=O)C1 |
| InChI | InChI=1S/C22H23Cl2N9O3/c1-31-8-9-32(19(34)12-31)17-11-28-22(30-20(17)14-3-2-13(23)10-15(14)24)27-7-6-26-18-5-4-16(33(35)36)21(25)29-18/h2-5,10-11H,6-9,12H2,1H3,(H3,25,26,29)(H,27,28,30) |
| InChIKey | WVICCKVXWUMEBF-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 155.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.39 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|