About 2-methoxy-4-(4-methyl-5-methylsulfonyl-1,2,4-triazol-3-yl)pyridine
2-methoxy-4-(4-methyl-5-methylsulfonyl-1,2,4-triazol-3-yl)pyridine (PubChem CID 24851812) has the molecular formula C10H12N4O3S
and a molecular weight of 268.30 g/mol. Its IUPAC name is 2-methoxy-4-(4-methyl-5-methylsulfonyl-1,2,4-triazol-3-yl)pyridine.
Molecular Properties
| Compound Name | 2-methoxy-4-(4-methyl-5-methylsulfonyl-1,2,4-triazol-3-yl)pyridine |
| PubChem CID | 24851812 |
| Molecular Formula | C10H12N4O3S |
| Molecular Weight | 268.30 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 2-methoxy-4-(4-methyl-5-methylsulfonyl-1,2,4-triazol-3-yl)pyridine |
| SMILES | COc1cc(-c2nnc(S(C)(=O)=O)n2C)ccn1 |
| InChI | InChI=1S/C10H12N4O3S/c1-14-9(12-13-10(14)18(3,15)16)7-4-5-11-8(6-7)17-2/h4-6H,1-3H3 |
| InChIKey | XAKCXLMMOPJCIS-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 86.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.30 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-methoxy-4-(4-methyl-5-methylsulfonyl-1,2,4-triazol-3-yl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-4-(4-methyl-5-methylsulfonyl-1,2,4-triazol-3-yl)pyridine?
The IUPAC name of 2-methoxy-4-(4-methyl-5-methylsulfonyl-1,2,4-triazol-3-yl)pyridine (CID 24851812) is 2-methoxy-4-(4-methyl-5-methylsulfonyl-1,2,4-triazol-3-yl)pyridine.
What is the SMILES notation for 2-methoxy-4-(4-methyl-5-methylsulfonyl-1,2,4-triazol-3-yl)pyridine?
The canonical SMILES for 2-methoxy-4-(4-methyl-5-methylsulfonyl-1,2,4-triazol-3-yl)pyridine is COc1cc(-c2nnc(S(C)(=O)=O)n2C)ccn1.
What is the InChIKey of 2-methoxy-4-(4-methyl-5-methylsulfonyl-1,2,4-triazol-3-yl)pyridine?
The InChIKey is XAKCXLMMOPJCIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N4O3S/c1-14-9(12-13-10(14)18(3,15)16)7-4-5-11-8(6-7)17-2/h4-6H,1-3H3.
What are the key properties of 2-methoxy-4-(4-methyl-5-methylsulfonyl-1,2,4-triazol-3-yl)pyridine?
2-methoxy-4-(4-methyl-5-methylsulfonyl-1,2,4-triazol-3-yl)pyridine has a molecular weight of 268.30 g/mol, XLogP of 0.29, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-4-(4-methyl-5-methylsulfonyl-1,2,4-triazol-3-yl)pyridine is sourced from PubChem (CID 24851812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).