C15H24N4O4SSi — CID 24851814
4-(4-methyl-5-methylsulfonyl-1,2,4-triazol-3-yl)-1-(2-trimethylsilylethoxymethyl)pyridin-2-one (PubChem CID 24851814) has the molecular formula C15H24N4O4SSi and a molecular weight of 384.53 g/mol. Its IUPAC name is 4-(4-methyl-5-methylsulfonyl-1,2,4-triazol-3-yl)-1-(2-trimethylsilylethoxymethyl)pyridin-2-one.
| Compound Name | 4-(4-methyl-5-methylsulfonyl-1,2,4-triazol-3-yl)-1-(2-trimethylsilylethoxymethyl)pyridin-2-one |
|---|---|
| PubChem CID | 24851814 |
| Molecular Formula | C15H24N4O4SSi |
| Molecular Weight | 384.53 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | 4-(4-methyl-5-methylsulfonyl-1,2,4-triazol-3-yl)-1-(2-trimethylsilylethoxymethyl)pyridin-2-one |
| SMILES | Cn1c(-c2ccn(COCC[Si](C)(C)C)c(=O)c2)nnc1S(C)(=O)=O |
| InChI | InChI=1S/C15H24N4O4SSi/c1-18-14(16-17-15(18)24(2,21)22)12-6-7-19(13(20)10-12)11-23-8-9-25(3,4)5/h6-7,10H,8-9,11H2,1-5H3 |
| InChIKey | VDGMLENFLKKBGQ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 96.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.53 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|