About (Z)-4-(9-benzyl-3,6-dihydropurin-8-yl)-4-hydroxy-2-oxobut-3-enoic acid
(Z)-4-(9-benzyl-3,6-dihydropurin-8-yl)-4-hydroxy-2-oxobut-3-enoic acid (PubChem CID 24851849) has the molecular formula C16H14N4O4
and a molecular weight of 326.31 g/mol. Its IUPAC name is (Z)-4-(9-benzyl-3,6-dihydropurin-8-yl)-4-hydroxy-2-oxobut-3-enoic acid.
Molecular Properties
| Compound Name | (Z)-4-(9-benzyl-3,6-dihydropurin-8-yl)-4-hydroxy-2-oxobut-3-enoic acid |
| PubChem CID | 24851849 |
| Molecular Formula | C16H14N4O4 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | (Z)-4-(9-benzyl-3,6-dihydropurin-8-yl)-4-hydroxy-2-oxobut-3-enoic acid |
| SMILES | O=C(O)C(=O)/C=C(\O)c1nc2c(n1Cc1ccccc1)NC=NC2 |
| InChI | InChI=1S/C16H14N4O4/c21-12(6-13(22)16(23)24)15-19-11-7-17-9-18-14(11)20(15)8-10-4-2-1-3-5-10/h1-6,9,21H,7-8H2,(H,17,18)(H,23,24)/b12-6- |
| InChIKey | RTWVCAGEAGBEIC-SDQBBNPISA-N |
| XLogP | 1.44 |
| TPSA | 116.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-4-(9-benzyl-3,6-dihydropurin-8-yl)-4-hydroxy-2-oxobut-3-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-4-(9-benzyl-3,6-dihydropurin-8-yl)-4-hydroxy-2-oxobut-3-enoic acid?
The IUPAC name of (Z)-4-(9-benzyl-3,6-dihydropurin-8-yl)-4-hydroxy-2-oxobut-3-enoic acid (CID 24851849) is (Z)-4-(9-benzyl-3,6-dihydropurin-8-yl)-4-hydroxy-2-oxobut-3-enoic acid.
What is the SMILES notation for (Z)-4-(9-benzyl-3,6-dihydropurin-8-yl)-4-hydroxy-2-oxobut-3-enoic acid?
The canonical SMILES for (Z)-4-(9-benzyl-3,6-dihydropurin-8-yl)-4-hydroxy-2-oxobut-3-enoic acid is O=C(O)C(=O)/C=C(\O)c1nc2c(n1Cc1ccccc1)NC=NC2.
What is the InChIKey of (Z)-4-(9-benzyl-3,6-dihydropurin-8-yl)-4-hydroxy-2-oxobut-3-enoic acid?
The InChIKey is RTWVCAGEAGBEIC-SDQBBNPISA-N. The full InChI is InChI=1S/C16H14N4O4/c21-12(6-13(22)16(23)24)15-19-11-7-17-9-18-14(11)20(15)8-10-4-2-1-3-5-10/h1-6,9,21H,7-8H2,(H,17,18)(H,23,24)/b12-6-.
What are the key properties of (Z)-4-(9-benzyl-3,6-dihydropurin-8-yl)-4-hydroxy-2-oxobut-3-enoic acid?
(Z)-4-(9-benzyl-3,6-dihydropurin-8-yl)-4-hydroxy-2-oxobut-3-enoic acid has a molecular weight of 326.31 g/mol, XLogP of 1.44, 5 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4-(9-benzyl-3,6-dihydropurin-8-yl)-4-hydroxy-2-oxobut-3-enoic acid is sourced from PubChem (CID 24851849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).