C25H23F2N5O — CID 24851856
2-[(E)-2-[2-fluoro-5-methoxy-4-(4-methylimidazol-1-yl)phenyl]ethenyl]-8-(4-fluorophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 24851856) has the molecular formula C25H23F2N5O and a molecular weight of 447.49 g/mol. Its IUPAC name is 2-[(E)-2-[2-fluoro-5-methoxy-4-(4-methylimidazol-1-yl)phenyl]ethenyl]-8-(4-fluorophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 2-[(E)-2-[2-fluoro-5-methoxy-4-(4-methylimidazol-1-yl)phenyl]ethenyl]-8-(4-fluorophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 24851856 |
| Molecular Formula | C25H23F2N5O |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | 2-[(E)-2-[2-fluoro-5-methoxy-4-(4-methylimidazol-1-yl)phenyl]ethenyl]-8-(4-fluorophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | COc1cc(/C=C/c2nc3n(n2)CCCC3c2ccc(F)cc2)c(F)cc1-n1cnc(C)c1 |
| InChI | InChI=1S/C25H23F2N5O/c1-16-14-31(15-28-16)22-13-21(27)18(12-23(22)33-2)7-10-24-29-25-20(4-3-11-32(25)30-24)17-5-8-19(26)9-6-17/h5-10,12-15,20H,3-4,11H2,1-2H3/b10-7+ |
| InChIKey | FRSBIDGXMBDIFI-JXMROGBWSA-N |
| XLogP | 5.16 |
| TPSA | 57.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |