C19H25N3O2S — CID 2485199
N-[(2R)-4-phenylbutan-2-yl]-5-pyrrolidin-1-ylsulfonylpyridin-2-amine (PubChem CID 2485199) has the molecular formula C19H25N3O2S and a molecular weight of 359.50 g/mol. Its IUPAC name is N-[(2R)-4-phenylbutan-2-yl]-5-pyrrolidin-1-ylsulfonylpyridin-2-amine.
| Compound Name | N-[(2R)-4-phenylbutan-2-yl]-5-pyrrolidin-1-ylsulfonylpyridin-2-amine |
|---|---|
| PubChem CID | 2485199 |
| Molecular Formula | C19H25N3O2S |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | N-[(2R)-4-phenylbutan-2-yl]-5-pyrrolidin-1-ylsulfonylpyridin-2-amine |
| SMILES | C[C@H](CCc1ccccc1)Nc1ccc(S(=O)(=O)N2CCCC2)cn1 |
| InChI | InChI=1S/C19H25N3O2S/c1-16(9-10-17-7-3-2-4-8-17)21-19-12-11-18(15-20-19)25(23,24)22-13-5-6-14-22/h2-4,7-8,11-12,15-16H,5-6,9-10,13-14H2,1H3,(H,20,21)/t16-/m1/s1 |
| InChIKey | SBDNFUXFCWTFOK-MRXNPFEDSA-N |
| XLogP | 3.30 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |