C21H14ClF2N3O3 — CID 24852237
4-[1-[(2-chloro-3,6-difluorophenyl)methyl]-2-oxo-3,4-dihydropyrido[2,3-b]pyrazin-7-yl]benzoic acid (PubChem CID 24852237) has the molecular formula C21H14ClF2N3O3 and a molecular weight of 429.81 g/mol. Its IUPAC name is 4-[1-[(2-chloro-3,6-difluorophenyl)methyl]-2-oxo-3,4-dihydropyrido[2,3-b]pyrazin-7-yl]benzoic acid.
| Compound Name | 4-[1-[(2-chloro-3,6-difluorophenyl)methyl]-2-oxo-3,4-dihydropyrido[2,3-b]pyrazin-7-yl]benzoic acid |
|---|---|
| PubChem CID | 24852237 |
| Molecular Formula | C21H14ClF2N3O3 |
| Molecular Weight | 429.81 g/mol |
| Exact Mass | 429.07 |
| IUPAC Name | 4-[1-[(2-chloro-3,6-difluorophenyl)methyl]-2-oxo-3,4-dihydropyrido[2,3-b]pyrazin-7-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2cnc3c(c2)N(Cc2c(F)ccc(F)c2Cl)C(=O)CN3)cc1 |
| InChI | InChI=1S/C21H14ClF2N3O3/c22-19-14(15(23)5-6-16(19)24)10-27-17-7-13(8-25-20(17)26-9-18(27)28)11-1-3-12(4-2-11)21(29)30/h1-8H,9-10H2,(H,25,26)(H,29,30) |
| InChIKey | MAQQPHMYJHPTHD-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.81 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|