C24H21F4N3O4S — CID 24852298
(3Z)-1-methyl-3-[5-methyl-3-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-ylidene]-1-[(4-prop-2-enoxyphenyl)methyl]urea (PubChem CID 24852298) has the molecular formula C24H21F4N3O4S and a molecular weight of 523.51 g/mol. Its IUPAC name is (3Z)-1-methyl-3-[5-methyl-3-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-ylidene]-1-[(4-prop-2-enoxyphenyl)methyl]urea.
| Compound Name | (3Z)-1-methyl-3-[5-methyl-3-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-ylidene]-1-[(4-prop-2-enoxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 24852298 |
| Molecular Formula | C24H21F4N3O4S |
| Molecular Weight | 523.51 g/mol |
| Exact Mass | 523.12 |
| IUPAC Name | (3Z)-1-methyl-3-[5-methyl-3-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-ylidene]-1-[(4-prop-2-enoxyphenyl)methyl]urea |
| SMILES | C=CCOc1ccc(CN(C)C(=O)/N=c2\sc(C)cn2-c2ccc3c(c2)OC(F)(F)C(F)(F)O3)cc1 |
| InChI | InChI=1S/C24H21F4N3O4S/c1-4-11-33-18-8-5-16(6-9-18)14-30(3)21(32)29-22-31(13-15(2)36-22)17-7-10-19-20(12-17)35-24(27,28)23(25,26)34-19/h4-10,12-13H,1,11,14H2,2-3H3/b29-22- |
| InChIKey | KHSAONQASQGRSW-IADYIPOJSA-N |
| XLogP | 5.52 |
| TPSA | 65.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.51 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|