C24H19F4N3O3S — CID 24852521
(3Z)-1-benzyl-1-but-2-ynyl-3-[5-methyl-3-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-ylidene]urea (PubChem CID 24852521) has the molecular formula C24H19F4N3O3S and a molecular weight of 505.49 g/mol. Its IUPAC name is (3Z)-1-benzyl-1-but-2-ynyl-3-[5-methyl-3-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-ylidene]urea.
| Compound Name | (3Z)-1-benzyl-1-but-2-ynyl-3-[5-methyl-3-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-ylidene]urea |
|---|---|
| PubChem CID | 24852521 |
| Molecular Formula | C24H19F4N3O3S |
| Molecular Weight | 505.49 g/mol |
| Exact Mass | 505.11 |
| IUPAC Name | (3Z)-1-benzyl-1-but-2-ynyl-3-[5-methyl-3-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-ylidene]urea |
| SMILES | CC#CCN(Cc1ccccc1)C(=O)/N=c1\sc(C)cn1-c1ccc2c(c1)OC(F)(F)C(F)(F)O2 |
| InChI | InChI=1S/C24H19F4N3O3S/c1-3-4-12-30(15-17-8-6-5-7-9-17)21(32)29-22-31(14-16(2)35-22)18-10-11-19-20(13-18)34-24(27,28)23(25,26)33-19/h5-11,13-14H,12,15H2,1-2H3/b29-22- |
| InChIKey | ZVJKEGYPAQYNGE-IADYIPOJSA-N |
| XLogP | 5.35 |
| TPSA | 56.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.49 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|