About 4-(1-benzyl-2-oxo-3,4-dihydropyrido[2,3-b]pyrazin-7-yl)benzamide
4-(1-benzyl-2-oxo-3,4-dihydropyrido[2,3-b]pyrazin-7-yl)benzamide (PubChem CID 24852570) has the molecular formula C21H18N4O2
and a molecular weight of 358.40 g/mol. Its IUPAC name is 4-(1-benzyl-2-oxo-3,4-dihydropyrido[2,3-b]pyrazin-7-yl)benzamide.
Molecular Properties
| Compound Name | 4-(1-benzyl-2-oxo-3,4-dihydropyrido[2,3-b]pyrazin-7-yl)benzamide |
| PubChem CID | 24852570 |
| Molecular Formula | C21H18N4O2 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 4-(1-benzyl-2-oxo-3,4-dihydropyrido[2,3-b]pyrazin-7-yl)benzamide |
| SMILES | NC(=O)c1ccc(-c2cnc3c(c2)N(Cc2ccccc2)C(=O)CN3)cc1 |
| InChI | InChI=1S/C21H18N4O2/c22-20(27)16-8-6-15(7-9-16)17-10-18-21(23-11-17)24-12-19(26)25(18)13-14-4-2-1-3-5-14/h1-11H,12-13H2,(H2,22,27)(H,23,24) |
| InChIKey | WZHSWSZONPGHLN-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(1-benzyl-2-oxo-3,4-dihydropyrido[2,3-b]pyrazin-7-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-benzyl-2-oxo-3,4-dihydropyrido[2,3-b]pyrazin-7-yl)benzamide?
The IUPAC name of 4-(1-benzyl-2-oxo-3,4-dihydropyrido[2,3-b]pyrazin-7-yl)benzamide (CID 24852570) is 4-(1-benzyl-2-oxo-3,4-dihydropyrido[2,3-b]pyrazin-7-yl)benzamide.
What is the SMILES notation for 4-(1-benzyl-2-oxo-3,4-dihydropyrido[2,3-b]pyrazin-7-yl)benzamide?
The canonical SMILES for 4-(1-benzyl-2-oxo-3,4-dihydropyrido[2,3-b]pyrazin-7-yl)benzamide is NC(=O)c1ccc(-c2cnc3c(c2)N(Cc2ccccc2)C(=O)CN3)cc1.
What is the InChIKey of 4-(1-benzyl-2-oxo-3,4-dihydropyrido[2,3-b]pyrazin-7-yl)benzamide?
The InChIKey is WZHSWSZONPGHLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18N4O2/c22-20(27)16-8-6-15(7-9-16)17-10-18-21(23-11-17)24-12-19(26)25(18)13-14-4-2-1-3-5-14/h1-11H,12-13H2,(H2,22,27)(H,23,24).
What are the key properties of 4-(1-benzyl-2-oxo-3,4-dihydropyrido[2,3-b]pyrazin-7-yl)benzamide?
4-(1-benzyl-2-oxo-3,4-dihydropyrido[2,3-b]pyrazin-7-yl)benzamide has a molecular weight of 358.40 g/mol, XLogP of 2.81, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-benzyl-2-oxo-3,4-dihydropyrido[2,3-b]pyrazin-7-yl)benzamide is sourced from PubChem (CID 24852570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).