C18H19F4N3O4S — CID 24852630
(3Z)-1-(1-methoxybutan-2-yl)-3-[5-methyl-3-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-ylidene]urea (PubChem CID 24852630) has the molecular formula C18H19F4N3O4S and a molecular weight of 449.43 g/mol. Its IUPAC name is (3Z)-1-(1-methoxybutan-2-yl)-3-[5-methyl-3-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-ylidene]urea.
| Compound Name | (3Z)-1-(1-methoxybutan-2-yl)-3-[5-methyl-3-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-ylidene]urea |
|---|---|
| PubChem CID | 24852630 |
| Molecular Formula | C18H19F4N3O4S |
| Molecular Weight | 449.43 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | (3Z)-1-(1-methoxybutan-2-yl)-3-[5-methyl-3-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-ylidene]urea |
| SMILES | CCC(COC)NC(=O)/N=c1\sc(C)cn1-c1ccc2c(c1)OC(F)(F)C(F)(F)O2 |
| InChI | InChI=1S/C18H19F4N3O4S/c1-4-11(9-27-3)23-15(26)24-16-25(8-10(2)30-16)12-5-6-13-14(7-12)29-18(21,22)17(19,20)28-13/h5-8,11H,4,9H2,1-3H3,(H,23,26)/b24-16- |
| InChIKey | NUHYHDWMHSFKLZ-JLPGSUDCSA-N |
| XLogP | 3.84 |
| TPSA | 74.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.43 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|