C21H17F4N3O4S — CID 24852632
(3Z)-1-[(1S)-2-hydroxy-1-phenylethyl]-3-[5-methyl-3-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-ylidene]urea (PubChem CID 24852632) has the molecular formula C21H17F4N3O4S and a molecular weight of 483.44 g/mol. Its IUPAC name is (3Z)-1-[(1S)-2-hydroxy-1-phenylethyl]-3-[5-methyl-3-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-ylidene]urea.
| Compound Name | (3Z)-1-[(1S)-2-hydroxy-1-phenylethyl]-3-[5-methyl-3-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-ylidene]urea |
|---|---|
| PubChem CID | 24852632 |
| Molecular Formula | C21H17F4N3O4S |
| Molecular Weight | 483.44 g/mol |
| Exact Mass | 483.09 |
| IUPAC Name | (3Z)-1-[(1S)-2-hydroxy-1-phenylethyl]-3-[5-methyl-3-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-ylidene]urea |
| SMILES | Cc1cn(-c2ccc3c(c2)OC(F)(F)C(F)(F)O3)/c(=N/C(=O)N[C@H](CO)c2ccccc2)s1 |
| InChI | InChI=1S/C21H17F4N3O4S/c1-12-10-28(14-7-8-16-17(9-14)32-21(24,25)20(22,23)31-16)19(33-12)27-18(30)26-15(11-29)13-5-3-2-4-6-13/h2-10,15,29H,11H2,1H3,(H,26,30)/b27-19-/t15-/m1/s1 |
| InChIKey | UDIATZLRFSVYEB-PZYRRFEBSA-N |
| XLogP | 4.15 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.44 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|