C21H17F4N3O3S — CID 24852736
(1Z)-1-[5-methyl-3-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-ylidene]-3-[(1R)-1-phenylethyl]urea (PubChem CID 24852736) has the molecular formula C21H17F4N3O3S and a molecular weight of 467.44 g/mol. Its IUPAC name is (1Z)-1-[5-methyl-3-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-ylidene]-3-[(1R)-1-phenylethyl]urea.
| Compound Name | (1Z)-1-[5-methyl-3-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-ylidene]-3-[(1R)-1-phenylethyl]urea |
|---|---|
| PubChem CID | 24852736 |
| Molecular Formula | C21H17F4N3O3S |
| Molecular Weight | 467.44 g/mol |
| Exact Mass | 467.09 |
| IUPAC Name | (1Z)-1-[5-methyl-3-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-ylidene]-3-[(1R)-1-phenylethyl]urea |
| SMILES | Cc1cn(-c2ccc3c(c2)OC(F)(F)C(F)(F)O3)/c(=N/C(=O)N[C@H](C)c2ccccc2)s1 |
| InChI | InChI=1S/C21H17F4N3O3S/c1-12-11-28(15-8-9-16-17(10-15)31-21(24,25)20(22,23)30-16)19(32-12)27-18(29)26-13(2)14-6-4-3-5-7-14/h3-11,13H,1-2H3,(H,26,29)/b27-19-/t13-/m1/s1 |
| InChIKey | XIXNPOFNXFDJTO-UKAFKNFTSA-N |
| XLogP | 5.18 |
| TPSA | 64.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.44 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|