C24H19F4N5 — CID 24853005
2-[(E)-2-[3-fluoro-4-(4-methylimidazol-1-yl)phenyl]ethenyl]-8-(3,4,5-trifluorophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 24853005) has the molecular formula C24H19F4N5 and a molecular weight of 453.44 g/mol. Its IUPAC name is 2-[(E)-2-[3-fluoro-4-(4-methylimidazol-1-yl)phenyl]ethenyl]-8-(3,4,5-trifluorophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 2-[(E)-2-[3-fluoro-4-(4-methylimidazol-1-yl)phenyl]ethenyl]-8-(3,4,5-trifluorophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 24853005 |
| Molecular Formula | C24H19F4N5 |
| Molecular Weight | 453.44 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | 2-[(E)-2-[3-fluoro-4-(4-methylimidazol-1-yl)phenyl]ethenyl]-8-(3,4,5-trifluorophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | Cc1cn(-c2ccc(/C=C/c3nc4n(n3)CCCC4c3cc(F)c(F)c(F)c3)cc2F)cn1 |
| InChI | InChI=1S/C24H19F4N5/c1-14-12-32(13-29-14)21-6-4-15(9-18(21)25)5-7-22-30-24-17(3-2-8-33(24)31-22)16-10-19(26)23(28)20(27)11-16/h4-7,9-13,17H,2-3,8H2,1H3/b7-5+ |
| InChIKey | JONHOTQRQYAIBY-FNORWQNLSA-N |
| XLogP | 5.42 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.44 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|