C25H26ClFN4O4 — CID 24853210
(10R,15S)-4-chloro-5-fluoro-13-[3-(2-hydroxyethylamino)propyl]-10-(3-hydroxyphenyl)-15-methyl-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraene-12,14-dione (PubChem CID 24853210) has the molecular formula C25H26ClFN4O4 and a molecular weight of 500.96 g/mol. Its IUPAC name is (10R,15S)-4-chloro-5-fluoro-13-[3-(2-hydroxyethylamino)propyl]-10-(3-hydroxyphenyl)-15-methyl-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraene-12,14-dione.
| Compound Name | (10R,15S)-4-chloro-5-fluoro-13-[3-(2-hydroxyethylamino)propyl]-10-(3-hydroxyphenyl)-15-methyl-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraene-12,14-dione |
|---|---|
| PubChem CID | 24853210 |
| Molecular Formula | C25H26ClFN4O4 |
| Molecular Weight | 500.96 g/mol |
| Exact Mass | 500.16 |
| IUPAC Name | (10R,15S)-4-chloro-5-fluoro-13-[3-(2-hydroxyethylamino)propyl]-10-(3-hydroxyphenyl)-15-methyl-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraene-12,14-dione |
| SMILES | C[C@@]12Cc3c([nH]c4cc(F)c(Cl)cc34)[C@@H](c3cccc(O)c3)N1C(=O)N(CCCNCCO)C2=O |
| InChI | InChI=1S/C25H26ClFN4O4/c1-25-13-17-16-11-18(26)19(27)12-20(16)29-21(17)22(14-4-2-5-15(33)10-14)31(25)24(35)30(23(25)34)8-3-6-28-7-9-32/h2,4-5,10-12,22,28-29,32-33H,3,6-9,13H2,1H3/t22-,25+/m1/s1 |
| InChIKey | CZFWHFWWYGDSRC-RDGATRHJSA-N |
| XLogP | 3.31 |
| TPSA | 108.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.96 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|