C23H26O9 — CID 24853539
[(2S,6S,8R,12S,14R,15S)-14-hydroxy-15-methoxy-14,18-dimethyl-5-methylidene-4,10-dioxo-3,11,19-trioxatetracyclo[14.2.1.19,12.02,6]icosa-1(18),9(20),16-trien-8-yl] acetate (PubChem CID 24853539) has the molecular formula C23H26O9 and a molecular weight of 446.45 g/mol. Its IUPAC name is [(2S,6S,8R,12S,14R,15S)-14-hydroxy-15-methoxy-14,18-dimethyl-5-methylidene-4,10-dioxo-3,11,19-trioxatetracyclo[14.2.1.19,12.02,6]icosa-1(18),9(20),16-trien-8-yl] acetate.
| Compound Name | [(2S,6S,8R,12S,14R,15S)-14-hydroxy-15-methoxy-14,18-dimethyl-5-methylidene-4,10-dioxo-3,11,19-trioxatetracyclo[14.2.1.19,12.02,6]icosa-1(18),9(20),16-trien-8-yl] acetate |
|---|---|
| PubChem CID | 24853539 |
| Molecular Formula | C23H26O9 |
| Molecular Weight | 446.45 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | [(2S,6S,8R,12S,14R,15S)-14-hydroxy-15-methoxy-14,18-dimethyl-5-methylidene-4,10-dioxo-3,11,19-trioxatetracyclo[14.2.1.19,12.02,6]icosa-1(18),9(20),16-trien-8-yl] acetate |
| SMILES | C=C1C(=O)O[C@@H]2c3oc(cc3C)[C@@H](OC)[C@](C)(O)C[C@H]3C=C(C(=O)O3)[C@H](OC(C)=O)C[C@@H]12 |
| InChI | InChI=1S/C23H26O9/c1-10-6-17-20(28-5)23(4,27)9-13-7-15(22(26)30-13)16(29-12(3)24)8-14-11(2)21(25)32-19(14)18(10)31-17/h6-7,13-14,16,19-20,27H,2,8-9H2,1,3-5H3/t13-,14+,16-,19+,20-,23-/m1/s1 |
| InChIKey | GXPJROHGAPZOAA-AZQXYKMHSA-N |
| XLogP | 2.37 |
| TPSA | 121.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.45 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|