C20H24O6 — CID 24853542
(1S,2S,4R,6S,12S,13S)-1-hydroxy-4,15-dimethyl-12-prop-1-en-2-yl-3,7,17-trioxatetracyclo[11.3.1.16,9.02,4]octadeca-9(18),15-diene-8,14-dione (PubChem CID 24853542) has the molecular formula C20H24O6 and a molecular weight of 360.41 g/mol. Its IUPAC name is (1S,2S,4R,6S,12S,13S)-1-hydroxy-4,15-dimethyl-12-prop-1-en-2-yl-3,7,17-trioxatetracyclo[11.3.1.16,9.02,4]octadeca-9(18),15-diene-8,14-dione.
| Compound Name | (1S,2S,4R,6S,12S,13S)-1-hydroxy-4,15-dimethyl-12-prop-1-en-2-yl-3,7,17-trioxatetracyclo[11.3.1.16,9.02,4]octadeca-9(18),15-diene-8,14-dione |
|---|---|
| PubChem CID | 24853542 |
| Molecular Formula | C20H24O6 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | (1S,2S,4R,6S,12S,13S)-1-hydroxy-4,15-dimethyl-12-prop-1-en-2-yl-3,7,17-trioxatetracyclo[11.3.1.16,9.02,4]octadeca-9(18),15-diene-8,14-dione |
| SMILES | C=C(C)[C@@H]1CCC2=C[C@H](C[C@@]3(C)O[C@@H]3[C@]3(O)C=C(C)C(=O)[C@H]1O3)OC2=O |
| InChI | InChI=1S/C20H24O6/c1-10(2)14-6-5-12-7-13(24-17(12)22)9-19(4)18(26-19)20(23)8-11(3)15(21)16(14)25-20/h7-8,13-14,16,18,23H,1,5-6,9H2,2-4H3/t13-,14+,16+,18+,19-,20+/m1/s1 |
| InChIKey | SMFDDGNKJZPWQS-HOWIIGCRSA-N |
| XLogP | 1.97 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|