About 7-(aziridin-1-yl)-2-phenylquinoline-5,8-dione
7-(aziridin-1-yl)-2-phenylquinoline-5,8-dione (PubChem CID 24853870) has the molecular formula C17H12N2O2
and a molecular weight of 276.30 g/mol. Its IUPAC name is 7-(aziridin-1-yl)-2-phenylquinoline-5,8-dione.
Molecular Properties
| Compound Name | 7-(aziridin-1-yl)-2-phenylquinoline-5,8-dione |
| PubChem CID | 24853870 |
| Molecular Formula | C17H12N2O2 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 7-(aziridin-1-yl)-2-phenylquinoline-5,8-dione |
| SMILES | O=C1C=C(N2CC2)C(=O)c2nc(-c3ccccc3)ccc21 |
| InChI | InChI=1S/C17H12N2O2/c20-15-10-14(19-8-9-19)17(21)16-12(15)6-7-13(18-16)11-4-2-1-3-5-11/h1-7,10H,8-9H2 |
| InChIKey | VDYWTWQAJRAUGO-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 50.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 7-(aziridin-1-yl)-2-phenylquinoline-5,8-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(aziridin-1-yl)-2-phenylquinoline-5,8-dione?
The IUPAC name of 7-(aziridin-1-yl)-2-phenylquinoline-5,8-dione (CID 24853870) is 7-(aziridin-1-yl)-2-phenylquinoline-5,8-dione.
What is the SMILES notation for 7-(aziridin-1-yl)-2-phenylquinoline-5,8-dione?
The canonical SMILES for 7-(aziridin-1-yl)-2-phenylquinoline-5,8-dione is O=C1C=C(N2CC2)C(=O)c2nc(-c3ccccc3)ccc21.
What is the InChIKey of 7-(aziridin-1-yl)-2-phenylquinoline-5,8-dione?
The InChIKey is VDYWTWQAJRAUGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12N2O2/c20-15-10-14(19-8-9-19)17(21)16-12(15)6-7-13(18-16)11-4-2-1-3-5-11/h1-7,10H,8-9H2.
What are the key properties of 7-(aziridin-1-yl)-2-phenylquinoline-5,8-dione?
7-(aziridin-1-yl)-2-phenylquinoline-5,8-dione has a molecular weight of 276.30 g/mol, XLogP of 2.33, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(aziridin-1-yl)-2-phenylquinoline-5,8-dione is sourced from PubChem (CID 24853870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).