C13H16O6 — CID 24853884
(1S,3R,3'R,7R,8Z,10R)-3'-hydroxy-3-methylspiro[4,11-dioxabicyclo[8.1.0]undec-8-ene-7,5'-oxolane]-2',5-dione (PubChem CID 24853884) has the molecular formula C13H16O6 and a molecular weight of 268.26 g/mol. Its IUPAC name is (1S,3R,3'R,7R,8Z,10R)-3'-hydroxy-3-methylspiro[4,11-dioxabicyclo[8.1.0]undec-8-ene-7,5'-oxolane]-2',5-dione.
| Compound Name | (1S,3R,3'R,7R,8Z,10R)-3'-hydroxy-3-methylspiro[4,11-dioxabicyclo[8.1.0]undec-8-ene-7,5'-oxolane]-2',5-dione |
|---|---|
| PubChem CID | 24853884 |
| Molecular Formula | C13H16O6 |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | (1S,3R,3'R,7R,8Z,10R)-3'-hydroxy-3-methylspiro[4,11-dioxabicyclo[8.1.0]undec-8-ene-7,5'-oxolane]-2',5-dione |
| SMILES | C[C@@H]1C[C@@H]2O[C@@H]2/C=C\[C@]2(CC(=O)O1)C[C@@H](O)C(=O)O2 |
| InChI | InChI=1S/C13H16O6/c1-7-4-10-9(18-10)2-3-13(6-11(15)17-7)5-8(14)12(16)19-13/h2-3,7-10,14H,4-6H2,1H3/b3-2-/t7-,8-,9-,10+,13-/m1/s1 |
| InChIKey | MPBXBRPXWNZKJE-VPHIQXKFSA-N |
| XLogP | 0.08 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.26 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|