About [(E)-4-(5-chloro-2,4-dioxopyrimidin-1-yl)but-2-enyl]phosphonic acid
[(E)-4-(5-chloro-2,4-dioxopyrimidin-1-yl)but-2-enyl]phosphonic acid (PubChem CID 24853891) has the molecular formula C8H10ClN2O5P
and a molecular weight of 280.60 g/mol. Its IUPAC name is [(E)-4-(5-chloro-2,4-dioxopyrimidin-1-yl)but-2-enyl]phosphonic acid.
Molecular Properties
| Compound Name | [(E)-4-(5-chloro-2,4-dioxopyrimidin-1-yl)but-2-enyl]phosphonic acid |
| PubChem CID | 24853891 |
| Molecular Formula | C8H10ClN2O5P |
| Molecular Weight | 280.60 g/mol |
| Exact Mass | 280.00 |
| IUPAC Name | [(E)-4-(5-chloro-2,4-dioxopyrimidin-1-yl)but-2-enyl]phosphonic acid |
| SMILES | O=c1[nH]c(=O)n(C/C=C/CP(=O)(O)O)cc1Cl |
| InChI | InChI=1S/C8H10ClN2O5P/c9-6-5-11(8(13)10-7(6)12)3-1-2-4-17(14,15)16/h1-2,5H,3-4H2,(H,10,12,13)(H2,14,15,16)/b2-1+ |
| InChIKey | OJNXTNOGLCWOBG-OWOJBTEDSA-N |
| XLogP | -0.08 |
| TPSA | 112.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.60 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [(E)-4-(5-chloro-2,4-dioxopyrimidin-1-yl)but-2-enyl]phosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-4-(5-chloro-2,4-dioxopyrimidin-1-yl)but-2-enyl]phosphonic acid?
The IUPAC name of [(E)-4-(5-chloro-2,4-dioxopyrimidin-1-yl)but-2-enyl]phosphonic acid (CID 24853891) is [(E)-4-(5-chloro-2,4-dioxopyrimidin-1-yl)but-2-enyl]phosphonic acid.
What is the SMILES notation for [(E)-4-(5-chloro-2,4-dioxopyrimidin-1-yl)but-2-enyl]phosphonic acid?
The canonical SMILES for [(E)-4-(5-chloro-2,4-dioxopyrimidin-1-yl)but-2-enyl]phosphonic acid is O=c1[nH]c(=O)n(C/C=C/CP(=O)(O)O)cc1Cl.
What is the InChIKey of [(E)-4-(5-chloro-2,4-dioxopyrimidin-1-yl)but-2-enyl]phosphonic acid?
The InChIKey is OJNXTNOGLCWOBG-OWOJBTEDSA-N. The full InChI is InChI=1S/C8H10ClN2O5P/c9-6-5-11(8(13)10-7(6)12)3-1-2-4-17(14,15)16/h1-2,5H,3-4H2,(H,10,12,13)(H2,14,15,16)/b2-1+.
What are the key properties of [(E)-4-(5-chloro-2,4-dioxopyrimidin-1-yl)but-2-enyl]phosphonic acid?
[(E)-4-(5-chloro-2,4-dioxopyrimidin-1-yl)but-2-enyl]phosphonic acid has a molecular weight of 280.60 g/mol, XLogP of -0.08, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-4-(5-chloro-2,4-dioxopyrimidin-1-yl)but-2-enyl]phosphonic acid is sourced from PubChem (CID 24853891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).