About CID 24853985
CID 24853985 (PubChem CID 24853985) has the molecular formula C33H39IrN2+
and a molecular weight of 655.91 g/mol.
Molecular Properties
| Compound Name | CID 24853985 |
| PubChem CID | 24853985 |
| Molecular Formula | C33H39IrN2+ |
| Molecular Weight | 655.91 g/mol |
| Exact Mass | 656.27 |
| IUPAC Name | — |
| SMILES | C[C]1[C](C)[C](C)[C](C)[C]1C.Cc1cc(C)c([N-][C@@H](c2ccccc2)[C@@H]([NH-])c2ccccc2)c(C)c1.[Ir+3] |
| InChI | InChI=1S/C23H24N2.C10H15.Ir/c1-16-14-17(2)22(18(3)15-16)25-23(20-12-8-5-9-13-20)21(24)19-10-6-4-7-11-19;1-6-7(2)9(4)10(5)8(6)3;/h4-15,21,23-24H,1-3H3;1-5H3;/q-2;;+3/t21-,23-;;/m0../s1 |
| InChIKey | DGWYCWRCGXFYBY-CPTHQKRGSA-N |
| XLogP | 10.12 |
| TPSA | 37.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 655.91 |
| LogP ≤ 5 | 10.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 24853985 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 24853985?
The IUPAC name of CID 24853985 (CID 24853985) is not available.
What is the SMILES notation for CID 24853985?
The canonical SMILES for CID 24853985 is C[C]1[C](C)[C](C)[C](C)[C]1C.Cc1cc(C)c([N-][C@@H](c2ccccc2)[C@@H]([NH-])c2ccccc2)c(C)c1.[Ir+3].
What is the InChIKey of CID 24853985?
The InChIKey is DGWYCWRCGXFYBY-CPTHQKRGSA-N. The full InChI is InChI=1S/C23H24N2.C10H15.Ir/c1-16-14-17(2)22(18(3)15-16)25-23(20-12-8-5-9-13-20)21(24)19-10-6-4-7-11-19;1-6-7(2)9(4)10(5)8(6)3;/h4-15,21,23-24H,1-3H3;1-5H3;/q-2;;+3/t21-,23-;;/m0../s1.
What are the key properties of CID 24853985?
CID 24853985 has a molecular weight of 655.91 g/mol, XLogP of 10.12, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 24853985 is sourced from PubChem (CID 24853985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).