C25H38O3S — CID 24853992
(1S,3aR,4R,7aS)-4-(benzenesulfonylmethyl)-7a-methyl-1-[(2S)-6-methylheptan-2-yl]-2,3,3a,4,6,7-hexahydro-1H-inden-5-one (PubChem CID 24853992) has the molecular formula C25H38O3S and a molecular weight of 418.64 g/mol. Its IUPAC name is (1S,3aR,4R,7aS)-4-(benzenesulfonylmethyl)-7a-methyl-1-[(2S)-6-methylheptan-2-yl]-2,3,3a,4,6,7-hexahydro-1H-inden-5-one.
| Compound Name | (1S,3aR,4R,7aS)-4-(benzenesulfonylmethyl)-7a-methyl-1-[(2S)-6-methylheptan-2-yl]-2,3,3a,4,6,7-hexahydro-1H-inden-5-one |
|---|---|
| PubChem CID | 24853992 |
| Molecular Formula | C25H38O3S |
| Molecular Weight | 418.64 g/mol |
| Exact Mass | 418.25 |
| IUPAC Name | (1S,3aR,4R,7aS)-4-(benzenesulfonylmethyl)-7a-methyl-1-[(2S)-6-methylheptan-2-yl]-2,3,3a,4,6,7-hexahydro-1H-inden-5-one |
| SMILES | CC(C)CCC[C@H](C)[C@@H]1CC[C@@H]2[C@@H](CS(=O)(=O)c3ccccc3)C(=O)CC[C@]21C |
| InChI | InChI=1S/C25H38O3S/c1-18(2)9-8-10-19(3)22-13-14-23-21(24(26)15-16-25(22,23)4)17-29(27,28)20-11-6-5-7-12-20/h5-7,11-12,18-19,21-23H,8-10,13-17H2,1-4H3/t19-,21+,22-,23+,25-/m0/s1 |
| InChIKey | DHPJJBPUOCQFSX-CFBSLSOZSA-N |
| XLogP | 5.93 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.64 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |