C23H24N2O5 — CID 24853996
ethyl (13R,17R)-13-ethyl-17-hydroxy-12,18-dioxo-1,11-diazapentacyclo[9.7.2.02,7.08,19.015,20]icosa-2,4,6,8(19),15(20)-pentaene-17-carboxylate (PubChem CID 24853996) has the molecular formula C23H24N2O5 and a molecular weight of 408.45 g/mol. Its IUPAC name is ethyl (13R,17R)-13-ethyl-17-hydroxy-12,18-dioxo-1,11-diazapentacyclo[9.7.2.02,7.08,19.015,20]icosa-2,4,6,8(19),15(20)-pentaene-17-carboxylate.
| Compound Name | ethyl (13R,17R)-13-ethyl-17-hydroxy-12,18-dioxo-1,11-diazapentacyclo[9.7.2.02,7.08,19.015,20]icosa-2,4,6,8(19),15(20)-pentaene-17-carboxylate |
|---|---|
| PubChem CID | 24853996 |
| Molecular Formula | C23H24N2O5 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | ethyl (13R,17R)-13-ethyl-17-hydroxy-12,18-dioxo-1,11-diazapentacyclo[9.7.2.02,7.08,19.015,20]icosa-2,4,6,8(19),15(20)-pentaene-17-carboxylate |
| SMILES | CCOC(=O)[C@@]1(O)CC2=C3c4c(c5ccccc5n4C1=O)CCN3C(=O)[C@H](CC)C2 |
| InChI | InChI=1S/C23H24N2O5/c1-3-13-11-14-12-23(29,22(28)30-4-2)21(27)25-17-8-6-5-7-15(17)16-9-10-24(20(13)26)18(14)19(16)25/h5-8,13,29H,3-4,9-12H2,1-2H3/t13-,23-/m1/s1 |
| InChIKey | YYTYEDMJCXJHOB-JCQPUDPBSA-N |
| XLogP | 2.51 |
| TPSA | 88.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|