C13H19NO4 — CID 24854024
(2S,3R,4S,5R)-2-[4-(dimethylamino)phenyl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 24854024) has the molecular formula C13H19NO4 and a molecular weight of 253.30 g/mol. Its IUPAC name is (2S,3R,4S,5R)-2-[4-(dimethylamino)phenyl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2S,3R,4S,5R)-2-[4-(dimethylamino)phenyl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 24854024 |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | (2S,3R,4S,5R)-2-[4-(dimethylamino)phenyl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | CN(C)c1ccc([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C13H19NO4/c1-14(2)9-5-3-8(4-6-9)13-12(17)11(16)10(7-15)18-13/h3-6,10-13,15-17H,7H2,1-2H3/t10-,11-,12-,13+/m1/s1 |
| InChIKey | ZJAHMWJGPKPJND-LPWJVIDDSA-N |
| XLogP | -0.09 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|