C36H46N4O — CID 24854047
(1S,2R,4S,12R,13S,16Z)-25-(9H-pyrido[3,4-b]indol-1-yl)-11,22-diazapentacyclo[11.11.2.12,22.02,12.04,11]heptacosa-16,25-dien-13-ol (PubChem CID 24854047) has the molecular formula C36H46N4O and a molecular weight of 550.79 g/mol. Its IUPAC name is (1S,2R,4S,12R,13S,16Z)-25-(9H-pyrido[3,4-b]indol-1-yl)-11,22-diazapentacyclo[11.11.2.12,22.02,12.04,11]heptacosa-16,25-dien-13-ol.
| Compound Name | (1S,2R,4S,12R,13S,16Z)-25-(9H-pyrido[3,4-b]indol-1-yl)-11,22-diazapentacyclo[11.11.2.12,22.02,12.04,11]heptacosa-16,25-dien-13-ol |
|---|---|
| PubChem CID | 24854047 |
| Molecular Formula | C36H46N4O |
| Molecular Weight | 550.79 g/mol |
| Exact Mass | 550.37 |
| IUPAC Name | (1S,2R,4S,12R,13S,16Z)-25-(9H-pyrido[3,4-b]indol-1-yl)-11,22-diazapentacyclo[11.11.2.12,22.02,12.04,11]heptacosa-16,25-dien-13-ol |
| SMILES | O[C@]12C=C(c3nccc4c3[nH]c3ccccc34)[C@H]3CCN(CCCC/C=C\CC1)C[C@@]31C[C@@H]3CCCCCCN3[C@H]12 |
| InChI | InChI=1S/C36H46N4O/c41-36-18-10-4-1-2-5-11-20-39-22-17-30(35(25-39)23-26-13-7-3-6-12-21-40(26)34(35)36)29(24-36)32-33-28(16-19-37-32)27-14-8-9-15-31(27)38-33/h1,4,8-9,14-16,19,24,26,30,34,38,41H,2-3,5-7,10-13,17-18,20-23,25H2/b4-1-/t26-,30+,34+,35-,36-/m0/s1 |
| InChIKey | NDTBNCBZGFIGSO-TXEXIQKLSA-N |
| XLogP | 7.08 |
| TPSA | 55.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.79 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|