C18H15ClO6 — CID 24854051
2-(1-chloro-2,3-dihydroxypropan-2-yl)-10-hydroxy-1,2-dihydrofuro[3,2-a]xanthen-11-one (PubChem CID 24854051) has the molecular formula C18H15ClO6 and a molecular weight of 362.77 g/mol. Its IUPAC name is 2-(1-chloro-2,3-dihydroxypropan-2-yl)-10-hydroxy-1,2-dihydrofuro[3,2-a]xanthen-11-one.
| Compound Name | 2-(1-chloro-2,3-dihydroxypropan-2-yl)-10-hydroxy-1,2-dihydrofuro[3,2-a]xanthen-11-one |
|---|---|
| PubChem CID | 24854051 |
| Molecular Formula | C18H15ClO6 |
| Molecular Weight | 362.77 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | 2-(1-chloro-2,3-dihydroxypropan-2-yl)-10-hydroxy-1,2-dihydrofuro[3,2-a]xanthen-11-one |
| SMILES | O=c1c2c(O)cccc2oc2ccc3c(c12)CC(C(O)(CO)CCl)O3 |
| InChI | InChI=1S/C18H15ClO6/c19-7-18(23,8-20)14-6-9-11(25-14)4-5-13-15(9)17(22)16-10(21)2-1-3-12(16)24-13/h1-5,14,20-21,23H,6-8H2 |
| InChIKey | RJDOXCXLBLHXNV-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.77 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|