C30H30O9 — CID 24854180
methyl (2S,4aR,6aR,7R,9S,10aS,10bR)-9-(1-benzofuran-2-carbonyloxy)-2-(furan-3-yl)-6a,10b-dimethyl-4,10-dioxo-2,4a,5,6,7,8,9,10a-octahydro-1H-benzo[f]isochromene-7-carboxylate (PubChem CID 24854180) has the molecular formula C30H30O9 and a molecular weight of 534.56 g/mol. Its IUPAC name is methyl (2S,4aR,6aR,7R,9S,10aS,10bR)-9-(1-benzofuran-2-carbonyloxy)-2-(furan-3-yl)-6a,10b-dimethyl-4,10-dioxo-2,4a,5,6,7,8,9,10a-octahydro-1H-benzo[f]isochromene-7-carboxylate.
| Compound Name | methyl (2S,4aR,6aR,7R,9S,10aS,10bR)-9-(1-benzofuran-2-carbonyloxy)-2-(furan-3-yl)-6a,10b-dimethyl-4,10-dioxo-2,4a,5,6,7,8,9,10a-octahydro-1H-benzo[f]isochromene-7-carboxylate |
|---|---|
| PubChem CID | 24854180 |
| Molecular Formula | C30H30O9 |
| Molecular Weight | 534.56 g/mol |
| Exact Mass | 534.19 |
| IUPAC Name | methyl (2S,4aR,6aR,7R,9S,10aS,10bR)-9-(1-benzofuran-2-carbonyloxy)-2-(furan-3-yl)-6a,10b-dimethyl-4,10-dioxo-2,4a,5,6,7,8,9,10a-octahydro-1H-benzo[f]isochromene-7-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@H](OC(=O)c2cc3ccccc3o2)C(=O)[C@H]2[C@@]1(C)CC[C@H]1C(=O)O[C@H](c3ccoc3)C[C@]21C |
| InChI | InChI=1S/C30H30O9/c1-29-10-8-18-27(33)39-23(17-9-11-36-15-17)14-30(18,2)25(29)24(31)21(13-19(29)26(32)35-3)38-28(34)22-12-16-6-4-5-7-20(16)37-22/h4-7,9,11-12,15,18-19,21,23,25H,8,10,13-14H2,1-3H3/t18-,19-,21-,23-,25-,29-,30-/m0/s1 |
| InChIKey | LMEHDXHLTZLSLY-KJOAITKCSA-N |
| XLogP | 5.04 |
| TPSA | 122.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.56 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|