C17H22O5 — CID 24854221
dimethyl (3aS,4R,7aR)-3-methylidene-4-prop-2-enoxy-3a,4,7,7a-tetrahydro-2H-indene-1,1-dicarboxylate (PubChem CID 24854221) has the molecular formula C17H22O5 and a molecular weight of 306.36 g/mol. Its IUPAC name is dimethyl (3aS,4R,7aR)-3-methylidene-4-prop-2-enoxy-3a,4,7,7a-tetrahydro-2H-indene-1,1-dicarboxylate.
| Compound Name | dimethyl (3aS,4R,7aR)-3-methylidene-4-prop-2-enoxy-3a,4,7,7a-tetrahydro-2H-indene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 24854221 |
| Molecular Formula | C17H22O5 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | dimethyl (3aS,4R,7aR)-3-methylidene-4-prop-2-enoxy-3a,4,7,7a-tetrahydro-2H-indene-1,1-dicarboxylate |
| SMILES | C=CCO[C@@H]1C=CC[C@@H]2[C@H]1C(=C)CC2(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C17H22O5/c1-5-9-22-13-8-6-7-12-14(13)11(2)10-17(12,15(18)20-3)16(19)21-4/h5-6,8,12-14H,1-2,7,9-10H2,3-4H3/t12-,13-,14-/m1/s1 |
| InChIKey | CICYKIYEZUQCBJ-MGPQQGTHSA-N |
| XLogP | 2.04 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|