C18H24Cl2N2O4 — CID 24854280
3-methoxy-6-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]benzene-1,2-diamine;dihydrochloride (PubChem CID 24854280) has the molecular formula C18H24Cl2N2O4 and a molecular weight of 403.31 g/mol. Its IUPAC name is 3-methoxy-6-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]benzene-1,2-diamine;dihydrochloride.
| Compound Name | 3-methoxy-6-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]benzene-1,2-diamine;dihydrochloride |
|---|---|
| PubChem CID | 24854280 |
| Molecular Formula | C18H24Cl2N2O4 |
| Molecular Weight | 403.31 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | 3-methoxy-6-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]benzene-1,2-diamine;dihydrochloride |
| SMILES | COc1ccc(/C=C\c2cc(OC)c(OC)c(OC)c2)c(N)c1N.Cl.Cl |
| InChI | InChI=1S/C18H22N2O4.2ClH/c1-21-13-8-7-12(16(19)17(13)20)6-5-11-9-14(22-2)18(24-4)15(10-11)23-3;;/h5-10H,19-20H2,1-4H3;2*1H/b6-5-;; |
| InChIKey | BVTLAOJTURQVOP-XNOMRPDFSA-N |
| XLogP | 3.90 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.31 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|