C23H40O4Si — CID 24854678
[(6E,10E)-12-[tert-butyl(dimethyl)silyl]oxy-3,7,11-trimethyldodeca-6,10-dien-1-yn-3-yl] methyl carbonate (PubChem CID 24854678) has the molecular formula C23H40O4Si and a molecular weight of 408.66 g/mol. Its IUPAC name is [(6E,10E)-12-[tert-butyl(dimethyl)silyl]oxy-3,7,11-trimethyldodeca-6,10-dien-1-yn-3-yl] methyl carbonate.
| Compound Name | [(6E,10E)-12-[tert-butyl(dimethyl)silyl]oxy-3,7,11-trimethyldodeca-6,10-dien-1-yn-3-yl] methyl carbonate |
|---|---|
| PubChem CID | 24854678 |
| Molecular Formula | C23H40O4Si |
| Molecular Weight | 408.66 g/mol |
| Exact Mass | 408.27 |
| IUPAC Name | [(6E,10E)-12-[tert-butyl(dimethyl)silyl]oxy-3,7,11-trimethyldodeca-6,10-dien-1-yn-3-yl] methyl carbonate |
| SMILES | C#CC(C)(CC/C=C(\C)CC/C=C(\C)CO[Si](C)(C)C(C)(C)C)OC(=O)OC |
| InChI | InChI=1S/C23H40O4Si/c1-11-23(7,27-21(24)25-8)17-13-16-19(2)14-12-15-20(3)18-26-28(9,10)22(4,5)6/h1,15-16H,12-14,17-18H2,2-10H3/b19-16+,20-15+ |
| InChIKey | AIFNGFSIPZNBRW-RHBFVARBSA-N |
| XLogP | 6.64 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.66 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|