About 2-[5-[(4-fluorophenyl)methyl]-4-methyl-1,3-thiazol-2-yl]guanidine;hydrochloride
2-[5-[(4-fluorophenyl)methyl]-4-methyl-1,3-thiazol-2-yl]guanidine;hydrochloride (PubChem CID 24854745) has the molecular formula C12H14ClFN4S
and a molecular weight of 300.79 g/mol. Its IUPAC name is 2-[5-[(4-fluorophenyl)methyl]-4-methyl-1,3-thiazol-2-yl]guanidine;hydrochloride.
Molecular Properties
| Compound Name | 2-[5-[(4-fluorophenyl)methyl]-4-methyl-1,3-thiazol-2-yl]guanidine;hydrochloride |
| PubChem CID | 24854745 |
| Molecular Formula | C12H14ClFN4S |
| Molecular Weight | 300.79 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | 2-[5-[(4-fluorophenyl)methyl]-4-methyl-1,3-thiazol-2-yl]guanidine;hydrochloride |
| SMILES | Cc1nc(N=C(N)N)sc1Cc1ccc(F)cc1.Cl |
| InChI | InChI=1S/C12H13FN4S.ClH/c1-7-10(18-12(16-7)17-11(14)15)6-8-2-4-9(13)5-3-8;/h2-5H,6H2,1H3,(H4,14,15,16,17);1H |
| InChIKey | SSKQZVZQJNKXCX-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.79 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[5-[(4-fluorophenyl)methyl]-4-methyl-1,3-thiazol-2-yl]guanidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-[(4-fluorophenyl)methyl]-4-methyl-1,3-thiazol-2-yl]guanidine;hydrochloride?
The IUPAC name of 2-[5-[(4-fluorophenyl)methyl]-4-methyl-1,3-thiazol-2-yl]guanidine;hydrochloride (CID 24854745) is 2-[5-[(4-fluorophenyl)methyl]-4-methyl-1,3-thiazol-2-yl]guanidine;hydrochloride.
What is the SMILES notation for 2-[5-[(4-fluorophenyl)methyl]-4-methyl-1,3-thiazol-2-yl]guanidine;hydrochloride?
The canonical SMILES for 2-[5-[(4-fluorophenyl)methyl]-4-methyl-1,3-thiazol-2-yl]guanidine;hydrochloride is Cc1nc(N=C(N)N)sc1Cc1ccc(F)cc1.Cl.
What is the InChIKey of 2-[5-[(4-fluorophenyl)methyl]-4-methyl-1,3-thiazol-2-yl]guanidine;hydrochloride?
The InChIKey is SSKQZVZQJNKXCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13FN4S.ClH/c1-7-10(18-12(16-7)17-11(14)15)6-8-2-4-9(13)5-3-8;/h2-5H,6H2,1H3,(H4,14,15,16,17);1H.
What are the key properties of 2-[5-[(4-fluorophenyl)methyl]-4-methyl-1,3-thiazol-2-yl]guanidine;hydrochloride?
2-[5-[(4-fluorophenyl)methyl]-4-methyl-1,3-thiazol-2-yl]guanidine;hydrochloride has a molecular weight of 300.79 g/mol, XLogP of 2.51, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-[(4-fluorophenyl)methyl]-4-methyl-1,3-thiazol-2-yl]guanidine;hydrochloride is sourced from PubChem (CID 24854745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).