C14H13ClN4S — CID 24854754
2-(4-naphthalen-2-yl-1,3-thiazol-2-yl)guanidine;hydrochloride (PubChem CID 24854754) has the molecular formula C14H13ClN4S and a molecular weight of 304.81 g/mol. Its IUPAC name is 2-(4-naphthalen-2-yl-1,3-thiazol-2-yl)guanidine;hydrochloride.
| Compound Name | 2-(4-naphthalen-2-yl-1,3-thiazol-2-yl)guanidine;hydrochloride |
|---|---|
| PubChem CID | 24854754 |
| Molecular Formula | C14H13ClN4S |
| Molecular Weight | 304.81 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 2-(4-naphthalen-2-yl-1,3-thiazol-2-yl)guanidine;hydrochloride |
| SMILES | Cl.NC(N)=Nc1nc(-c2ccc3ccccc3c2)cs1 |
| InChI | InChI=1S/C14H12N4S.ClH/c15-13(16)18-14-17-12(8-19-14)11-6-5-9-3-1-2-4-10(9)7-11;/h1-8H,(H4,15,16,17,18);1H |
| InChIKey | PSTCYSDYKORNOM-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.81 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|