About 4-(6,7-dimethoxyquinazolin-4-yl)-2-[4-(trifluoromethyl)phenyl]morpholine
4-(6,7-dimethoxyquinazolin-4-yl)-2-[4-(trifluoromethyl)phenyl]morpholine (PubChem CID 24855236) has the molecular formula C21H20F3N3O3
and a molecular weight of 419.40 g/mol. Its IUPAC name is 4-(6,7-dimethoxyquinazolin-4-yl)-2-[4-(trifluoromethyl)phenyl]morpholine.
Molecular Properties
| Compound Name | 4-(6,7-dimethoxyquinazolin-4-yl)-2-[4-(trifluoromethyl)phenyl]morpholine |
| PubChem CID | 24855236 |
| Molecular Formula | C21H20F3N3O3 |
| Molecular Weight | 419.40 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | 4-(6,7-dimethoxyquinazolin-4-yl)-2-[4-(trifluoromethyl)phenyl]morpholine |
| SMILES | COc1cc2ncnc(N3CCOC(c4ccc(C(F)(F)F)cc4)C3)c2cc1OC |
| InChI | InChI=1S/C21H20F3N3O3/c1-28-17-9-15-16(10-18(17)29-2)25-12-26-20(15)27-7-8-30-19(11-27)13-3-5-14(6-4-13)21(22,23)24/h3-6,9-10,12,19H,7-8,11H2,1-2H3 |
| InChIKey | XAIODTXFYVURIH-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 56.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.40 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(6,7-dimethoxyquinazolin-4-yl)-2-[4-(trifluoromethyl)phenyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(6,7-dimethoxyquinazolin-4-yl)-2-[4-(trifluoromethyl)phenyl]morpholine?
The IUPAC name of 4-(6,7-dimethoxyquinazolin-4-yl)-2-[4-(trifluoromethyl)phenyl]morpholine (CID 24855236) is 4-(6,7-dimethoxyquinazolin-4-yl)-2-[4-(trifluoromethyl)phenyl]morpholine.
What is the SMILES notation for 4-(6,7-dimethoxyquinazolin-4-yl)-2-[4-(trifluoromethyl)phenyl]morpholine?
The canonical SMILES for 4-(6,7-dimethoxyquinazolin-4-yl)-2-[4-(trifluoromethyl)phenyl]morpholine is COc1cc2ncnc(N3CCOC(c4ccc(C(F)(F)F)cc4)C3)c2cc1OC.
What is the InChIKey of 4-(6,7-dimethoxyquinazolin-4-yl)-2-[4-(trifluoromethyl)phenyl]morpholine?
The InChIKey is XAIODTXFYVURIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20F3N3O3/c1-28-17-9-15-16(10-18(17)29-2)25-12-26-20(15)27-7-8-30-19(11-27)13-3-5-14(6-4-13)21(22,23)24/h3-6,9-10,12,19H,7-8,11H2,1-2H3.
What are the key properties of 4-(6,7-dimethoxyquinazolin-4-yl)-2-[4-(trifluoromethyl)phenyl]morpholine?
4-(6,7-dimethoxyquinazolin-4-yl)-2-[4-(trifluoromethyl)phenyl]morpholine has a molecular weight of 419.40 g/mol, XLogP of 4.24, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(6,7-dimethoxyquinazolin-4-yl)-2-[4-(trifluoromethyl)phenyl]morpholine is sourced from PubChem (CID 24855236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).