C13H10Cl2F3N5OS — CID 24855605
2-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-N-[2,6-dichloro-4-(trifluoromethyl)phenyl]acetamide (PubChem CID 24855605) has the molecular formula C13H10Cl2F3N5OS and a molecular weight of 412.22 g/mol. Its IUPAC name is 2-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-N-[2,6-dichloro-4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-N-[2,6-dichloro-4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 24855605 |
| Molecular Formula | C13H10Cl2F3N5OS |
| Molecular Weight | 412.22 g/mol |
| Exact Mass | 410.99 |
| IUPAC Name | 2-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-N-[2,6-dichloro-4-(trifluoromethyl)phenyl]acetamide |
| SMILES | NC(N)=Nc1nc(CC(=O)Nc2c(Cl)cc(C(F)(F)F)cc2Cl)cs1 |
| InChI | InChI=1S/C13H10Cl2F3N5OS/c14-7-1-5(13(16,17)18)2-8(15)10(7)22-9(24)3-6-4-25-12(21-6)23-11(19)20/h1-2,4H,3H2,(H,22,24)(H4,19,20,21,23) |
| InChIKey | IFPQIPRJALSKRL-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 106.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.22 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|